C16H24N4O3 — CID 169211132
ethyl 3-(4-amino-2-oxa-8-azaspiro[4.5]decan-8-yl)-5-methylpyrazine-2-carboxylate (PubChem CID 169211132) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is ethyl 3-(4-amino-2-oxa-8-azaspiro[4.5]decan-8-yl)-5-methylpyrazine-2-carboxylate.
| Compound Name | ethyl 3-(4-amino-2-oxa-8-azaspiro[4.5]decan-8-yl)-5-methylpyrazine-2-carboxylate |
|---|---|
| PubChem CID | 169211132 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | ethyl 3-(4-amino-2-oxa-8-azaspiro[4.5]decan-8-yl)-5-methylpyrazine-2-carboxylate |
| SMILES | CCOC(=O)c1ncc(C)nc1N1CCC2(CC1)COCC2N |
| InChI | InChI=1S/C16H24N4O3/c1-3-23-15(21)13-14(19-11(2)8-18-13)20-6-4-16(5-7-20)10-22-9-12(16)17/h8,12H,3-7,9-10,17H2,1-2H3 |
| InChIKey | MLYCRFAWUJILAO-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |