C22H34N2 — CID 169211181
2-(1-cyclohexylpropan-2-yl)-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-propylimidazole (PubChem CID 169211181) has the molecular formula C22H34N2 and a molecular weight of 326.53 g/mol. Its IUPAC name is 2-(1-cyclohexylpropan-2-yl)-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-propylimidazole.
| Compound Name | 2-(1-cyclohexylpropan-2-yl)-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-propylimidazole |
|---|---|
| PubChem CID | 169211181 |
| Molecular Formula | C22H34N2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | 2-(1-cyclohexylpropan-2-yl)-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-propylimidazole |
| SMILES | C=C/C=C(\C=C/C)c1cn(CCC)c(C(C)CC2CCCCC2)n1 |
| InChI | InChI=1S/C22H34N2/c1-5-11-20(12-6-2)21-17-24(15-7-3)22(23-21)18(4)16-19-13-9-8-10-14-19/h5-6,11-12,17-19H,1,7-10,13-16H2,2-4H3/b12-6-,20-11+ |
| InChIKey | SMPYJDOVYYDRHS-BLRQKTNUSA-N |
| XLogP | 6.51 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|