About N-[(3,3-difluorocyclobutyl)methyl]-3-phenyloxaziridine-2-carboxamide
N-[(3,3-difluorocyclobutyl)methyl]-3-phenyloxaziridine-2-carboxamide (PubChem CID 169211315) has the molecular formula C13H14F2N2O2
and a molecular weight of 268.26 g/mol. Its IUPAC name is N-[(3,3-difluorocyclobutyl)methyl]-3-phenyloxaziridine-2-carboxamide.
Molecular Properties
| Compound Name | N-[(3,3-difluorocyclobutyl)methyl]-3-phenyloxaziridine-2-carboxamide |
| PubChem CID | 169211315 |
| Molecular Formula | C13H14F2N2O2 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | N-[(3,3-difluorocyclobutyl)methyl]-3-phenyloxaziridine-2-carboxamide |
| SMILES | O=C(NCC1CC(F)(F)C1)N1OC1c1ccccc1 |
| InChI | InChI=1S/C13H14F2N2O2/c14-13(15)6-9(7-13)8-16-12(18)17-11(19-17)10-4-2-1-3-5-10/h1-5,9,11H,6-8H2,(H,16,18) |
| InChIKey | IUGYUTGQLVLJRA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 44.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,3-difluorocyclobutyl)methyl]-3-phenyloxaziridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,3-difluorocyclobutyl)methyl]-3-phenyloxaziridine-2-carboxamide?
The IUPAC name of N-[(3,3-difluorocyclobutyl)methyl]-3-phenyloxaziridine-2-carboxamide (CID 169211315) is N-[(3,3-difluorocyclobutyl)methyl]-3-phenyloxaziridine-2-carboxamide.
What is the SMILES notation for N-[(3,3-difluorocyclobutyl)methyl]-3-phenyloxaziridine-2-carboxamide?
The canonical SMILES for N-[(3,3-difluorocyclobutyl)methyl]-3-phenyloxaziridine-2-carboxamide is O=C(NCC1CC(F)(F)C1)N1OC1c1ccccc1.
What is the InChIKey of N-[(3,3-difluorocyclobutyl)methyl]-3-phenyloxaziridine-2-carboxamide?
The InChIKey is IUGYUTGQLVLJRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F2N2O2/c14-13(15)6-9(7-13)8-16-12(18)17-11(19-17)10-4-2-1-3-5-10/h1-5,9,11H,6-8H2,(H,16,18).
What are the key properties of N-[(3,3-difluorocyclobutyl)methyl]-3-phenyloxaziridine-2-carboxamide?
N-[(3,3-difluorocyclobutyl)methyl]-3-phenyloxaziridine-2-carboxamide has a molecular weight of 268.26 g/mol, XLogP of 2.69, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,3-difluorocyclobutyl)methyl]-3-phenyloxaziridine-2-carboxamide is sourced from PubChem (CID 169211315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).