C24H22F5N5O — CID 169211538
2,6-difluoro-3-[1-methyl-6-(methylamino)pyrazolo[3,4-d]pyrimidin-3-yl]-5-(trifluoromethyl)phenol;1,2,3,4-tetrahydronaphthalene (PubChem CID 169211538) has the molecular formula C24H22F5N5O and a molecular weight of 491.46 g/mol. Its IUPAC name is 2,6-difluoro-3-[1-methyl-6-(methylamino)pyrazolo[3,4-d]pyrimidin-3-yl]-5-(trifluoromethyl)phenol;1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2,6-difluoro-3-[1-methyl-6-(methylamino)pyrazolo[3,4-d]pyrimidin-3-yl]-5-(trifluoromethyl)phenol;1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 169211538 |
| Molecular Formula | C24H22F5N5O |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 2,6-difluoro-3-[1-methyl-6-(methylamino)pyrazolo[3,4-d]pyrimidin-3-yl]-5-(trifluoromethyl)phenol;1,2,3,4-tetrahydronaphthalene |
| SMILES | CNc1ncc2c(-c3cc(C(F)(F)F)c(F)c(O)c3F)nn(C)c2n1.c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C14H10F5N5O.C10H12/c1-20-13-21-4-6-10(23-24(2)12(6)22-13)5-3-7(14(17,18)19)9(16)11(25)8(5)15;1-2-6-10-8-4-3-7-9(10)5-1/h3-4,25H,1-2H3,(H,20,21,22);1-2,5-6H,3-4,7-8H2 |
| InChIKey | SPRIMVVWTOYKRI-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |