C25H27F6N5O3 — CID 169213336
3-[[4-[[(E,3Z)-1-amino-4,4,4-trifluoro-3-pyridin-2-yliminobut-1-en-2-yl]amino]phenyl]methyl-methylcarbamoyl]cyclobutane-1-carboxylic acid;1,1,1-trifluoroethane (PubChem CID 169213336) has the molecular formula C25H27F6N5O3 and a molecular weight of 559.51 g/mol. Its IUPAC name is 3-[[4-[[(E,3Z)-1-amino-4,4,4-trifluoro-3-pyridin-2-yliminobut-1-en-2-yl]amino]phenyl]methyl-methylcarbamoyl]cyclobutane-1-carboxylic acid;1,1,1-trifluoroethane.
| Compound Name | 3-[[4-[[(E,3Z)-1-amino-4,4,4-trifluoro-3-pyridin-2-yliminobut-1-en-2-yl]amino]phenyl]methyl-methylcarbamoyl]cyclobutane-1-carboxylic acid;1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 169213336 |
| Molecular Formula | C25H27F6N5O3 |
| Molecular Weight | 559.51 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | 3-[[4-[[(E,3Z)-1-amino-4,4,4-trifluoro-3-pyridin-2-yliminobut-1-en-2-yl]amino]phenyl]methyl-methylcarbamoyl]cyclobutane-1-carboxylic acid;1,1,1-trifluoroethane |
| SMILES | CC(F)(F)F.CN(Cc1ccc(NC(=C/N)/C(=N/c2ccccn2)C(F)(F)F)cc1)C(=O)C1CC(C(=O)O)C1 |
| InChI | InChI=1S/C23H24F3N5O3.C2H3F3/c1-31(21(32)15-10-16(11-15)22(33)34)13-14-5-7-17(8-6-14)29-18(12-27)20(23(24,25)26)30-19-4-2-3-9-28-19;1-2(3,4)5/h2-9,12,15-16,29H,10-11,13,27H2,1H3,(H,33,34);1H3/b18-12+,30-20-; |
| InChIKey | WKWNHASWEJTIEP-ADHBGKQASA-N |
| XLogP | 5.27 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|