C9H9F3N4 — CID 169213347
(E)-4,4,4-trifluoro-3-pyridin-3-yliminobut-1-ene-1,2-diamine (PubChem CID 169213347) has the molecular formula C9H9F3N4 and a molecular weight of 230.19 g/mol. Its IUPAC name is (E)-4,4,4-trifluoro-3-pyridin-3-yliminobut-1-ene-1,2-diamine.
| Compound Name | (E)-4,4,4-trifluoro-3-pyridin-3-yliminobut-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 169213347 |
| Molecular Formula | C9H9F3N4 |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | (E)-4,4,4-trifluoro-3-pyridin-3-yliminobut-1-ene-1,2-diamine |
| SMILES | N/C=C(N)\C(=N\c1cccnc1)C(F)(F)F |
| InChI | InChI=1S/C9H9F3N4/c10-9(11,12)8(7(14)4-13)16-6-2-1-3-15-5-6/h1-5H,13-14H2/b7-4+,16-8- |
| InChIKey | FMSNUWPSLRNDRF-QSJINSDNSA-N |
| XLogP | 1.48 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|