C5H8F3N3 — CID 169213382
(E)-4,4,4-trifluoro-3-methyliminobut-1-ene-1,2-diamine (PubChem CID 169213382) has the molecular formula C5H8F3N3 and a molecular weight of 167.13 g/mol. Its IUPAC name is (E)-4,4,4-trifluoro-3-methyliminobut-1-ene-1,2-diamine.
| Compound Name | (E)-4,4,4-trifluoro-3-methyliminobut-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 169213382 |
| Molecular Formula | C5H8F3N3 |
| Molecular Weight | 167.13 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | (E)-4,4,4-trifluoro-3-methyliminobut-1-ene-1,2-diamine |
| SMILES | C/N=C(C(/N)=C\N)\C(F)(F)F |
| InChI | InChI=1S/C5H8F3N3/c1-11-4(3(10)2-9)5(6,7)8/h2H,9-10H2,1H3/b3-2+,11-4- |
| InChIKey | LZYOIJNBNCDGNE-ICKRUQPGSA-N |
| XLogP | 0.38 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.13 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|