C11H12F3N3 — CID 169213393
(E)-4,4,4-trifluoro-3-(2-methylphenyl)iminobut-1-ene-1,2-diamine (PubChem CID 169213393) has the molecular formula C11H12F3N3 and a molecular weight of 243.23 g/mol. Its IUPAC name is (E)-4,4,4-trifluoro-3-(2-methylphenyl)iminobut-1-ene-1,2-diamine.
| Compound Name | (E)-4,4,4-trifluoro-3-(2-methylphenyl)iminobut-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 169213393 |
| Molecular Formula | C11H12F3N3 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | (E)-4,4,4-trifluoro-3-(2-methylphenyl)iminobut-1-ene-1,2-diamine |
| SMILES | Cc1ccccc1/N=C(C(/N)=C\N)\C(F)(F)F |
| InChI | InChI=1S/C11H12F3N3/c1-7-4-2-3-5-9(7)17-10(8(16)6-15)11(12,13)14/h2-6H,15-16H2,1H3/b8-6+,17-10- |
| InChIKey | KOHMFTWYSNSZFL-CYPPJGAXSA-N |
| XLogP | 2.39 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|