C7H12F3N3 — CID 169213599
(E)-4,4,4-trifluoro-3-propan-2-yliminobut-1-ene-1,2-diamine (PubChem CID 169213599) has the molecular formula C7H12F3N3 and a molecular weight of 195.19 g/mol. Its IUPAC name is (E)-4,4,4-trifluoro-3-propan-2-yliminobut-1-ene-1,2-diamine.
| Compound Name | (E)-4,4,4-trifluoro-3-propan-2-yliminobut-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 169213599 |
| Molecular Formula | C7H12F3N3 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | (E)-4,4,4-trifluoro-3-propan-2-yliminobut-1-ene-1,2-diamine |
| SMILES | CC(C)/N=C(C(/N)=C\N)\C(F)(F)F |
| InChI | InChI=1S/C7H12F3N3/c1-4(2)13-6(5(12)3-11)7(8,9)10/h3-4H,11-12H2,1-2H3/b5-3+,13-6- |
| InChIKey | BXRKICOFVGCQHZ-WIMOKQHYSA-N |
| XLogP | 1.16 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|