C16H16N2O6 — CID 169214430
2-[5-[[2-(3-methoxyphenoxy)acetyl]amino]-2-oxo-1-pyridinyl]acetic acid (PubChem CID 169214430) has the molecular formula C16H16N2O6 and a molecular weight of 332.31 g/mol. Its IUPAC name is 2-[5-[[2-(3-methoxyphenoxy)acetyl]amino]-2-oxo-1-pyridinyl]acetic acid.
| Compound Name | 2-[5-[[2-(3-methoxyphenoxy)acetyl]amino]-2-oxo-1-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 169214430 |
| Molecular Formula | C16H16N2O6 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 2-[5-[[2-(3-methoxyphenoxy)acetyl]amino]-2-oxo-1-pyridinyl]acetic acid |
| SMILES | COc1cccc(OCC(=O)Nc2ccc(=O)n(CC(=O)O)c2)c1 |
| InChI | InChI=1S/C16H16N2O6/c1-23-12-3-2-4-13(7-12)24-10-14(19)17-11-5-6-15(20)18(8-11)9-16(21)22/h2-8H,9-10H2,1H3,(H,17,19)(H,21,22) |
| InChIKey | XNAZZYPXSXPHOS-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |