C21H33ClN6O7 — CID 169214475
2-[5-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl-(piperidine-3-carbonyl)amino]-2-oxo-1-pyridinyl]acetic acid;hydrochloride (PubChem CID 169214475) has the molecular formula C21H33ClN6O7 and a molecular weight of 516.98 g/mol. Its IUPAC name is 2-[5-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl-(piperidine-3-carbonyl)amino]-2-oxo-1-pyridinyl]acetic acid;hydrochloride.
| Compound Name | 2-[5-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl-(piperidine-3-carbonyl)amino]-2-oxo-1-pyridinyl]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 169214475 |
| Molecular Formula | C21H33ClN6O7 |
| Molecular Weight | 516.98 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | 2-[5-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl-(piperidine-3-carbonyl)amino]-2-oxo-1-pyridinyl]acetic acid;hydrochloride |
| SMILES | Cl.[N-]=[N+]=NCCOCCOCCOCCN(C(=O)C1CCCNC1)c1ccc(=O)n(CC(=O)O)c1 |
| InChI | InChI=1S/C21H32N6O7.ClH/c22-25-24-6-8-32-10-12-34-13-11-33-9-7-27(21(31)17-2-1-5-23-14-17)18-3-4-19(28)26(15-18)16-20(29)30;/h3-4,15,17,23H,1-2,5-14,16H2,(H,29,30);1H |
| InChIKey | UIIZJIOHQRXGOU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 168.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.98 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|