About methyl-[3-[3-[methyl(methylsulfanylcarbonyl)amino]propoxy]propyl]azanide;vanadium
methyl-[3-[3-[methyl(methylsulfanylcarbonyl)amino]propoxy]propyl]azanide;vanadium (PubChem CID 169214932) has the molecular formula C10H21N2O2SV-
and a molecular weight of 284.30 g/mol. Its IUPAC name is methyl-[3-[3-[methyl(methylsulfanylcarbonyl)amino]propoxy]propyl]azanide;vanadium.
Molecular Properties
| Compound Name | methyl-[3-[3-[methyl(methylsulfanylcarbonyl)amino]propoxy]propyl]azanide;vanadium |
| PubChem CID | 169214932 |
| Molecular Formula | C10H21N2O2SV- |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | methyl-[3-[3-[methyl(methylsulfanylcarbonyl)amino]propoxy]propyl]azanide;vanadium |
| SMILES | C[N-]CCCOCCCN(C)C(=O)SC.[V] |
| InChI | InChI=1S/C10H21N2O2S.V/c1-11-6-4-8-14-9-5-7-12(2)10(13)15-3;/h4-9H2,1-3H3;/q-1; |
| InChIKey | JTCARILIJIAPTL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 43.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze methyl-[3-[3-[methyl(methylsulfanylcarbonyl)amino]propoxy]propyl]azanide;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-[3-[3-[methyl(methylsulfanylcarbonyl)amino]propoxy]propyl]azanide;vanadium?
The IUPAC name of methyl-[3-[3-[methyl(methylsulfanylcarbonyl)amino]propoxy]propyl]azanide;vanadium (CID 169214932) is methyl-[3-[3-[methyl(methylsulfanylcarbonyl)amino]propoxy]propyl]azanide;vanadium.
What is the SMILES notation for methyl-[3-[3-[methyl(methylsulfanylcarbonyl)amino]propoxy]propyl]azanide;vanadium?
The canonical SMILES for methyl-[3-[3-[methyl(methylsulfanylcarbonyl)amino]propoxy]propyl]azanide;vanadium is C[N-]CCCOCCCN(C)C(=O)SC.[V].
What is the InChIKey of methyl-[3-[3-[methyl(methylsulfanylcarbonyl)amino]propoxy]propyl]azanide;vanadium?
The InChIKey is JTCARILIJIAPTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N2O2S.V/c1-11-6-4-8-14-9-5-7-12(2)10(13)15-3;/h4-9H2,1-3H3;/q-1;.
What are the key properties of methyl-[3-[3-[methyl(methylsulfanylcarbonyl)amino]propoxy]propyl]azanide;vanadium?
methyl-[3-[3-[methyl(methylsulfanylcarbonyl)amino]propoxy]propyl]azanide;vanadium has a molecular weight of 284.30 g/mol, XLogP of 2.20, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-[3-[3-[methyl(methylsulfanylcarbonyl)amino]propoxy]propyl]azanide;vanadium is sourced from PubChem (CID 169214932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).