About 4-butoxy-1-methylpiperidine;N-butyl-4-ethyl-N-methylcyclohexan-1-amine;ethane
4-butoxy-1-methylpiperidine;N-butyl-4-ethyl-N-methylcyclohexan-1-amine;ethane (PubChem CID 169214971) has the molecular formula C29H66N2O
and a molecular weight of 458.86 g/mol. Its IUPAC name is 4-butoxy-1-methylpiperidine;N-butyl-4-ethyl-N-methylcyclohexan-1-amine;ethane.
Molecular Properties
| Compound Name | 4-butoxy-1-methylpiperidine;N-butyl-4-ethyl-N-methylcyclohexan-1-amine;ethane |
| PubChem CID | 169214971 |
| Molecular Formula | C29H66N2O |
| Molecular Weight | 458.86 g/mol |
| Exact Mass | 458.52 |
| IUPAC Name | 4-butoxy-1-methylpiperidine;N-butyl-4-ethyl-N-methylcyclohexan-1-amine;ethane |
| SMILES | CC.CC.CC.CCCCN(C)C1CCC(CC)CC1.CCCCOC1CCN(C)CC1 |
| InChI | InChI=1S/C13H27N.C10H21NO.3C2H6/c1-4-6-11-14(3)13-9-7-12(5-2)8-10-13;1-3-4-9-12-10-5-7-11(2)8-6-10;3*1-2/h12-13H,4-11H2,1-3H3;10H,3-9H2,1-2H3;3*1-2H3 |
| InChIKey | SMFJNAYNGQRYDM-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.86 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-butoxy-1-methylpiperidine;N-butyl-4-ethyl-N-methylcyclohexan-1-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butoxy-1-methylpiperidine;N-butyl-4-ethyl-N-methylcyclohexan-1-amine;ethane?
The IUPAC name of 4-butoxy-1-methylpiperidine;N-butyl-4-ethyl-N-methylcyclohexan-1-amine;ethane (CID 169214971) is 4-butoxy-1-methylpiperidine;N-butyl-4-ethyl-N-methylcyclohexan-1-amine;ethane.
What is the SMILES notation for 4-butoxy-1-methylpiperidine;N-butyl-4-ethyl-N-methylcyclohexan-1-amine;ethane?
The canonical SMILES for 4-butoxy-1-methylpiperidine;N-butyl-4-ethyl-N-methylcyclohexan-1-amine;ethane is CC.CC.CC.CCCCN(C)C1CCC(CC)CC1.CCCCOC1CCN(C)CC1.
What is the InChIKey of 4-butoxy-1-methylpiperidine;N-butyl-4-ethyl-N-methylcyclohexan-1-amine;ethane?
The InChIKey is SMFJNAYNGQRYDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N.C10H21NO.3C2H6/c1-4-6-11-14(3)13-9-7-12(5-2)8-10-13;1-3-4-9-12-10-5-7-11(2)8-6-10;3*1-2/h12-13H,4-11H2,1-3H3;10H,3-9H2,1-2H3;3*1-2H3.
What are the key properties of 4-butoxy-1-methylpiperidine;N-butyl-4-ethyl-N-methylcyclohexan-1-amine;ethane?
4-butoxy-1-methylpiperidine;N-butyl-4-ethyl-N-methylcyclohexan-1-amine;ethane has a molecular weight of 458.86 g/mol, XLogP of 8.66, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butoxy-1-methylpiperidine;N-butyl-4-ethyl-N-methylcyclohexan-1-amine;ethane is sourced from PubChem (CID 169214971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).