About 3-tert-butyl-1-methylpyrazole-5-carboxamide;cyclobutylazanium;ethane
3-tert-butyl-1-methylpyrazole-5-carboxamide;cyclobutylazanium;ethane (PubChem CID 169215508) has the molecular formula C15H31N4O+
and a molecular weight of 283.44 g/mol. Its IUPAC name is 3-tert-butyl-1-methylpyrazole-5-carboxamide;cyclobutylazanium;ethane.
Molecular Properties
| Compound Name | 3-tert-butyl-1-methylpyrazole-5-carboxamide;cyclobutylazanium;ethane |
| PubChem CID | 169215508 |
| Molecular Formula | C15H31N4O+ |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | 3-tert-butyl-1-methylpyrazole-5-carboxamide;cyclobutylazanium;ethane |
| SMILES | CC.Cn1nc(C(C)(C)C)cc1C(N)=O.[NH3+]C1CCC1 |
| InChI | InChI=1S/C9H15N3O.C4H9N.C2H6/c1-9(2,3)7-5-6(8(10)13)12(4)11-7;5-4-2-1-3-4;1-2/h5H,1-4H3,(H2,10,13);4H,1-3,5H2;1-2H3/p+1 |
| InChIKey | AOHLFKLTTJBCQN-UHFFFAOYSA-O |
| XLogP | 1.62 |
| TPSA | 88.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-tert-butyl-1-methylpyrazole-5-carboxamide;cyclobutylazanium;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-1-methylpyrazole-5-carboxamide;cyclobutylazanium;ethane?
The IUPAC name of 3-tert-butyl-1-methylpyrazole-5-carboxamide;cyclobutylazanium;ethane (CID 169215508) is 3-tert-butyl-1-methylpyrazole-5-carboxamide;cyclobutylazanium;ethane.
What is the SMILES notation for 3-tert-butyl-1-methylpyrazole-5-carboxamide;cyclobutylazanium;ethane?
The canonical SMILES for 3-tert-butyl-1-methylpyrazole-5-carboxamide;cyclobutylazanium;ethane is CC.Cn1nc(C(C)(C)C)cc1C(N)=O.[NH3+]C1CCC1.
What is the InChIKey of 3-tert-butyl-1-methylpyrazole-5-carboxamide;cyclobutylazanium;ethane?
The InChIKey is AOHLFKLTTJBCQN-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H15N3O.C4H9N.C2H6/c1-9(2,3)7-5-6(8(10)13)12(4)11-7;5-4-2-1-3-4;1-2/h5H,1-4H3,(H2,10,13);4H,1-3,5H2;1-2H3/p+1.
What are the key properties of 3-tert-butyl-1-methylpyrazole-5-carboxamide;cyclobutylazanium;ethane?
3-tert-butyl-1-methylpyrazole-5-carboxamide;cyclobutylazanium;ethane has a molecular weight of 283.44 g/mol, XLogP of 1.62, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-1-methylpyrazole-5-carboxamide;cyclobutylazanium;ethane is sourced from PubChem (CID 169215508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).