C26H21ClFNO5 — CID 169217008
(1S,2S,6R,7R,8R,10S)-4-[4-[2-(3-chloro-4-methoxyphenyl)-2-oxoethoxy]-2-fluorophenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 169217008) has the molecular formula C26H21ClFNO5 and a molecular weight of 481.91 g/mol. Its IUPAC name is (1S,2S,6R,7R,8R,10S)-4-[4-[2-(3-chloro-4-methoxyphenyl)-2-oxoethoxy]-2-fluorophenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1S,2S,6R,7R,8R,10S)-4-[4-[2-(3-chloro-4-methoxyphenyl)-2-oxoethoxy]-2-fluorophenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 169217008 |
| Molecular Formula | C26H21ClFNO5 |
| Molecular Weight | 481.91 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | (1S,2S,6R,7R,8R,10S)-4-[4-[2-(3-chloro-4-methoxyphenyl)-2-oxoethoxy]-2-fluorophenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | COc1ccc(C(=O)COc2ccc(N3C(=O)[C@@H]4[C@@H]5C=C[C@@H]([C@H]6C[C@@H]56)[C@@H]4C3=O)c(F)c2)cc1Cl |
| InChI | InChI=1S/C26H21ClFNO5/c1-33-22-7-2-12(8-18(22)27)21(30)11-34-13-3-6-20(19(28)9-13)29-25(31)23-14-4-5-15(17-10-16(14)17)24(23)26(29)32/h2-9,14-17,23-24H,10-11H2,1H3/t14-,15+,16+,17-,23-,24+ |
| InChIKey | PUDOCMAXMOECMC-IGJCDXOPSA-N |
| XLogP | 4.31 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.91 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|