C26H20FNO6 — CID 169217052
(1S,2S,6R,7R,8R,10S)-4-[4-[2-(1,3-benzodioxol-5-yl)-2-oxoethoxy]-2-fluorophenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 169217052) has the molecular formula C26H20FNO6 and a molecular weight of 461.45 g/mol. Its IUPAC name is (1S,2S,6R,7R,8R,10S)-4-[4-[2-(1,3-benzodioxol-5-yl)-2-oxoethoxy]-2-fluorophenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1S,2S,6R,7R,8R,10S)-4-[4-[2-(1,3-benzodioxol-5-yl)-2-oxoethoxy]-2-fluorophenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 169217052 |
| Molecular Formula | C26H20FNO6 |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | (1S,2S,6R,7R,8R,10S)-4-[4-[2-(1,3-benzodioxol-5-yl)-2-oxoethoxy]-2-fluorophenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | O=C(COc1ccc(N2C(=O)[C@@H]3[C@@H]4C=C[C@@H]([C@H]5C[C@@H]45)[C@@H]3C2=O)c(F)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H20FNO6/c27-18-8-13(32-10-20(29)12-1-6-21-22(7-12)34-11-33-21)2-5-19(18)28-25(30)23-14-3-4-15(17-9-16(14)17)24(23)26(28)31/h1-8,14-17,23-24H,9-11H2/t14-,15+,16+,17-,23-,24+ |
| InChIKey | SHGTYGLJIOKNQG-IGJCDXOPSA-N |
| XLogP | 3.37 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|