C26H18ClF4NO4 — CID 169217078
(1S,2S,6R,7R,8R,10S)-4-[4-[2-[4-chloro-3-(trifluoromethyl)phenyl]-2-oxoethoxy]-2-fluorophenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 169217078) has the molecular formula C26H18ClF4NO4 and a molecular weight of 519.88 g/mol. Its IUPAC name is (1S,2S,6R,7R,8R,10S)-4-[4-[2-[4-chloro-3-(trifluoromethyl)phenyl]-2-oxoethoxy]-2-fluorophenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1S,2S,6R,7R,8R,10S)-4-[4-[2-[4-chloro-3-(trifluoromethyl)phenyl]-2-oxoethoxy]-2-fluorophenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 169217078 |
| Molecular Formula | C26H18ClF4NO4 |
| Molecular Weight | 519.88 g/mol |
| Exact Mass | 519.09 |
| IUPAC Name | (1S,2S,6R,7R,8R,10S)-4-[4-[2-[4-chloro-3-(trifluoromethyl)phenyl]-2-oxoethoxy]-2-fluorophenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | O=C(COc1ccc(N2C(=O)[C@@H]3[C@@H]4C=C[C@@H]([C@H]5C[C@@H]45)[C@@H]3C2=O)c(F)c1)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H18ClF4NO4/c27-18-5-1-11(7-17(18)26(29,30)31)21(33)10-36-12-2-6-20(19(28)8-12)32-24(34)22-13-3-4-14(16-9-15(13)16)23(22)25(32)35/h1-8,13-16,22-23H,9-10H2/t13-,14+,15+,16-,22-,23+ |
| InChIKey | VPFLKDSGMADGNF-XMHVXGHXSA-N |
| XLogP | 5.32 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.88 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|