C26H21ClFNO4 — CID 169217098
(1S,2S,6R,7R,8R,10S)-4-[4-[2-(4-chloro-3-methylphenyl)-2-oxoethoxy]-2-fluorophenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 169217098) has the molecular formula C26H21ClFNO4 and a molecular weight of 465.91 g/mol. Its IUPAC name is (1S,2S,6R,7R,8R,10S)-4-[4-[2-(4-chloro-3-methylphenyl)-2-oxoethoxy]-2-fluorophenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1S,2S,6R,7R,8R,10S)-4-[4-[2-(4-chloro-3-methylphenyl)-2-oxoethoxy]-2-fluorophenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 169217098 |
| Molecular Formula | C26H21ClFNO4 |
| Molecular Weight | 465.91 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | (1S,2S,6R,7R,8R,10S)-4-[4-[2-(4-chloro-3-methylphenyl)-2-oxoethoxy]-2-fluorophenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | Cc1cc(C(=O)COc2ccc(N3C(=O)[C@@H]4[C@@H]5C=C[C@@H]([C@H]6C[C@@H]56)[C@@H]4C3=O)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C26H21ClFNO4/c1-12-8-13(2-6-19(12)27)22(30)11-33-14-3-7-21(20(28)9-14)29-25(31)23-15-4-5-16(18-10-17(15)18)24(23)26(29)32/h2-9,15-18,23-24H,10-11H2,1H3/t15-,16+,17+,18-,23-,24+ |
| InChIKey | ONZWNLCGAORXMF-BIJSUVFWSA-N |
| XLogP | 4.61 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.91 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|