C25H23NO5 — CID 169217164
(1S,2R,6S,7R)-4-[4-[2-(4-methoxyphenyl)-2-oxoethoxy]phenyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 169217164) has the molecular formula C25H23NO5 and a molecular weight of 417.46 g/mol. Its IUPAC name is (1S,2R,6S,7R)-4-[4-[2-(4-methoxyphenyl)-2-oxoethoxy]phenyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | (1S,2R,6S,7R)-4-[4-[2-(4-methoxyphenyl)-2-oxoethoxy]phenyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 169217164 |
| Molecular Formula | C25H23NO5 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | (1S,2R,6S,7R)-4-[4-[2-(4-methoxyphenyl)-2-oxoethoxy]phenyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | COc1ccc(C(=O)COc2ccc(N3C(=O)[C@@H]4[C@H](C3=O)[C@@H]3C=C[C@H]4CC3)cc2)cc1 |
| InChI | InChI=1S/C25H23NO5/c1-30-19-10-6-15(7-11-19)21(27)14-31-20-12-8-18(9-13-20)26-24(28)22-16-2-3-17(5-4-16)23(22)25(26)29/h2-3,6-13,16-17,22-23H,4-5,14H2,1H3/t16-,17+,22-,23+ |
| InChIKey | OKKUHEMWTQPFNG-XFDIAKHOSA-N |
| XLogP | 3.66 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|