C9H13F3N2O — CID 169217856
2-methyl-1-[4-methyl-3-(trifluoromethyl)pyrazol-1-yl]propan-2-ol (PubChem CID 169217856) has the molecular formula C9H13F3N2O and a molecular weight of 222.21 g/mol. Its IUPAC name is 2-methyl-1-[4-methyl-3-(trifluoromethyl)pyrazol-1-yl]propan-2-ol.
| Compound Name | 2-methyl-1-[4-methyl-3-(trifluoromethyl)pyrazol-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 169217856 |
| Molecular Formula | C9H13F3N2O |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 2-methyl-1-[4-methyl-3-(trifluoromethyl)pyrazol-1-yl]propan-2-ol |
| SMILES | Cc1cn(CC(C)(C)O)nc1C(F)(F)F |
| InChI | InChI=1S/C9H13F3N2O/c1-6-4-14(5-8(2,3)15)13-7(6)9(10,11)12/h4,15H,5H2,1-3H3 |
| InChIKey | GYDHUFKIHAEHIM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |