About ethane;4-methyl-1-(2,2,2-trifluoroethyl)pyrazole-3-carbonitrile
ethane;4-methyl-1-(2,2,2-trifluoroethyl)pyrazole-3-carbonitrile (PubChem CID 169218001) has the molecular formula C9H12F3N3
and a molecular weight of 219.21 g/mol. Its IUPAC name is ethane;4-methyl-1-(2,2,2-trifluoroethyl)pyrazole-3-carbonitrile.
Molecular Properties
| Compound Name | ethane;4-methyl-1-(2,2,2-trifluoroethyl)pyrazole-3-carbonitrile |
| PubChem CID | 169218001 |
| Molecular Formula | C9H12F3N3 |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | ethane;4-methyl-1-(2,2,2-trifluoroethyl)pyrazole-3-carbonitrile |
| SMILES | CC.Cc1cn(CC(F)(F)F)nc1C#N |
| InChI | InChI=1S/C7H6F3N3.C2H6/c1-5-3-13(4-7(8,9)10)12-6(5)2-11;1-2/h3H,4H2,1H3;1-2H3 |
| InChIKey | YLFNRPXJGZMNKO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;4-methyl-1-(2,2,2-trifluoroethyl)pyrazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-1-(2,2,2-trifluoroethyl)pyrazole-3-carbonitrile?
The IUPAC name of ethane;4-methyl-1-(2,2,2-trifluoroethyl)pyrazole-3-carbonitrile (CID 169218001) is ethane;4-methyl-1-(2,2,2-trifluoroethyl)pyrazole-3-carbonitrile.
What is the SMILES notation for ethane;4-methyl-1-(2,2,2-trifluoroethyl)pyrazole-3-carbonitrile?
The canonical SMILES for ethane;4-methyl-1-(2,2,2-trifluoroethyl)pyrazole-3-carbonitrile is CC.Cc1cn(CC(F)(F)F)nc1C#N.
What is the InChIKey of ethane;4-methyl-1-(2,2,2-trifluoroethyl)pyrazole-3-carbonitrile?
The InChIKey is YLFNRPXJGZMNKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3N3.C2H6/c1-5-3-13(4-7(8,9)10)12-6(5)2-11;1-2/h3H,4H2,1H3;1-2H3.
What are the key properties of ethane;4-methyl-1-(2,2,2-trifluoroethyl)pyrazole-3-carbonitrile?
ethane;4-methyl-1-(2,2,2-trifluoroethyl)pyrazole-3-carbonitrile has a molecular weight of 219.21 g/mol, XLogP of 2.65, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-1-(2,2,2-trifluoroethyl)pyrazole-3-carbonitrile is sourced from PubChem (CID 169218001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).