About [2,2-dimethylpropanoyloxymethoxy(1-fluoroethyl)phosphoryl]oxymethyl 2,2-dimethylpropanoate
[2,2-dimethylpropanoyloxymethoxy(1-fluoroethyl)phosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 169218789) has the molecular formula C14H26FO7P
and a molecular weight of 356.33 g/mol. Its IUPAC name is [2,2-dimethylpropanoyloxymethoxy(1-fluoroethyl)phosphoryl]oxymethyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [2,2-dimethylpropanoyloxymethoxy(1-fluoroethyl)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| PubChem CID | 169218789 |
| Molecular Formula | C14H26FO7P |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | [2,2-dimethylpropanoyloxymethoxy(1-fluoroethyl)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(F)P(=O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H26FO7P/c1-10(15)23(18,21-8-19-11(16)13(2,3)4)22-9-20-12(17)14(5,6)7/h10H,8-9H2,1-7H3 |
| InChIKey | WCWISEVVBFIKPB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2,2-dimethylpropanoyloxymethoxy(1-fluoroethyl)phosphoryl]oxymethyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-dimethylpropanoyloxymethoxy(1-fluoroethyl)phosphoryl]oxymethyl 2,2-dimethylpropanoate?
The IUPAC name of [2,2-dimethylpropanoyloxymethoxy(1-fluoroethyl)phosphoryl]oxymethyl 2,2-dimethylpropanoate (CID 169218789) is [2,2-dimethylpropanoyloxymethoxy(1-fluoroethyl)phosphoryl]oxymethyl 2,2-dimethylpropanoate.
What is the SMILES notation for [2,2-dimethylpropanoyloxymethoxy(1-fluoroethyl)phosphoryl]oxymethyl 2,2-dimethylpropanoate?
The canonical SMILES for [2,2-dimethylpropanoyloxymethoxy(1-fluoroethyl)phosphoryl]oxymethyl 2,2-dimethylpropanoate is CC(F)P(=O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C.
What is the InChIKey of [2,2-dimethylpropanoyloxymethoxy(1-fluoroethyl)phosphoryl]oxymethyl 2,2-dimethylpropanoate?
The InChIKey is WCWISEVVBFIKPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26FO7P/c1-10(15)23(18,21-8-19-11(16)13(2,3)4)22-9-20-12(17)14(5,6)7/h10H,8-9H2,1-7H3.
What are the key properties of [2,2-dimethylpropanoyloxymethoxy(1-fluoroethyl)phosphoryl]oxymethyl 2,2-dimethylpropanoate?
[2,2-dimethylpropanoyloxymethoxy(1-fluoroethyl)phosphoryl]oxymethyl 2,2-dimethylpropanoate has a molecular weight of 356.33 g/mol, XLogP of 3.62, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-dimethylpropanoyloxymethoxy(1-fluoroethyl)phosphoryl]oxymethyl 2,2-dimethylpropanoate is sourced from PubChem (CID 169218789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).