About formaldehyde;methanol;5-methyl-1-pyrrolidin-1-ylhex-4-en-1-one
formaldehyde;methanol;5-methyl-1-pyrrolidin-1-ylhex-4-en-1-one (PubChem CID 169218835) has the molecular formula C13H25NO3
and a molecular weight of 243.35 g/mol. Its IUPAC name is formaldehyde;methanol;5-methyl-1-pyrrolidin-1-ylhex-4-en-1-one.
Molecular Properties
| Compound Name | formaldehyde;methanol;5-methyl-1-pyrrolidin-1-ylhex-4-en-1-one |
| PubChem CID | 169218835 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | formaldehyde;methanol;5-methyl-1-pyrrolidin-1-ylhex-4-en-1-one |
| SMILES | C=O.CC(C)=CCCC(=O)N1CCCC1.CO |
| InChI | InChI=1S/C11H19NO.CH4O.CH2O/c1-10(2)6-5-7-11(13)12-8-3-4-9-12;2*1-2/h6H,3-5,7-9H2,1-2H3;2H,1H3;1H2 |
| InChIKey | RZBHARPSNRTAKK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;methanol;5-methyl-1-pyrrolidin-1-ylhex-4-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;methanol;5-methyl-1-pyrrolidin-1-ylhex-4-en-1-one?
The IUPAC name of formaldehyde;methanol;5-methyl-1-pyrrolidin-1-ylhex-4-en-1-one (CID 169218835) is formaldehyde;methanol;5-methyl-1-pyrrolidin-1-ylhex-4-en-1-one.
What is the SMILES notation for formaldehyde;methanol;5-methyl-1-pyrrolidin-1-ylhex-4-en-1-one?
The canonical SMILES for formaldehyde;methanol;5-methyl-1-pyrrolidin-1-ylhex-4-en-1-one is C=O.CC(C)=CCCC(=O)N1CCCC1.CO.
What is the InChIKey of formaldehyde;methanol;5-methyl-1-pyrrolidin-1-ylhex-4-en-1-one?
The InChIKey is RZBHARPSNRTAKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO.CH4O.CH2O/c1-10(2)6-5-7-11(13)12-8-3-4-9-12;2*1-2/h6H,3-5,7-9H2,1-2H3;2H,1H3;1H2.
What are the key properties of formaldehyde;methanol;5-methyl-1-pyrrolidin-1-ylhex-4-en-1-one?
formaldehyde;methanol;5-methyl-1-pyrrolidin-1-ylhex-4-en-1-one has a molecular weight of 243.35 g/mol, XLogP of 1.78, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;methanol;5-methyl-1-pyrrolidin-1-ylhex-4-en-1-one is sourced from PubChem (CID 169218835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).