C30H31FN3O7PS — CID 169219102
[[2-[[(1R,3R,5S,10S)-10-(2,3-dihydro-1,4-benzoxazine-4-carbonyl)-8-oxo-9-azatricyclo[7.3.0.03,5]dodecan-7-yl]carbamoyl]-1-benzothiophen-5-yl]-fluoromethyl]phosphonic acid (PubChem CID 169219102) has the molecular formula C30H31FN3O7PS and a molecular weight of 627.63 g/mol. Its IUPAC name is [[2-[[(1R,3R,5S,10S)-10-(2,3-dihydro-1,4-benzoxazine-4-carbonyl)-8-oxo-9-azatricyclo[7.3.0.03,5]dodecan-7-yl]carbamoyl]-1-benzothiophen-5-yl]-fluoromethyl]phosphonic acid.
| Compound Name | [[2-[[(1R,3R,5S,10S)-10-(2,3-dihydro-1,4-benzoxazine-4-carbonyl)-8-oxo-9-azatricyclo[7.3.0.03,5]dodecan-7-yl]carbamoyl]-1-benzothiophen-5-yl]-fluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 169219102 |
| Molecular Formula | C30H31FN3O7PS |
| Molecular Weight | 627.63 g/mol |
| Exact Mass | 627.16 |
| IUPAC Name | [[2-[[(1R,3R,5S,10S)-10-(2,3-dihydro-1,4-benzoxazine-4-carbonyl)-8-oxo-9-azatricyclo[7.3.0.03,5]dodecan-7-yl]carbamoyl]-1-benzothiophen-5-yl]-fluoromethyl]phosphonic acid |
| SMILES | O=C(NC1C[C@@H]2C[C@@H]2C[C@H]2CC[C@@H](C(=O)N3CCOc4ccccc43)N2C1=O)c1cc2cc(C(F)P(=O)(O)O)ccc2s1 |
| InChI | InChI=1S/C30H31FN3O7PS/c31-27(42(38,39)40)16-5-8-25-19(11-16)15-26(43-25)28(35)32-21-14-18-12-17(18)13-20-6-7-23(34(20)29(21)36)30(37)33-9-10-41-24-4-2-1-3-22(24)33/h1-5,8,11,15,17-18,20-21,23,27H,6-7,9-10,12-14H2,(H,32,35)(H2,38,39,40)/t17-,18+,20-,21?,23+,27?/m1/s1 |
| InChIKey | WNBACHSNBGNDGC-KOBYTUGKSA-N |
| XLogP | 4.36 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.63 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|