About 6,6-difluoro-1,4-diazepane;hydrochloride
6,6-difluoro-1,4-diazepane;hydrochloride (PubChem CID 169219655) has the molecular formula C5H11ClF2N2
and a molecular weight of 172.61 g/mol. Its IUPAC name is 6,6-difluoro-1,4-diazepane;hydrochloride.
Molecular Properties
| Compound Name | 6,6-difluoro-1,4-diazepane;hydrochloride |
| PubChem CID | 169219655 |
| Molecular Formula | C5H11ClF2N2 |
| Molecular Weight | 172.61 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 6,6-difluoro-1,4-diazepane;hydrochloride |
| SMILES | Cl.FC1(F)CNCCNC1 |
| InChI | InChI=1S/C5H10F2N2.ClH/c6-5(7)3-8-1-2-9-4-5;/h8-9H,1-4H2;1H |
| InChIKey | WIUTXWOJBSKFLO-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.61 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,6-difluoro-1,4-diazepane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-difluoro-1,4-diazepane;hydrochloride?
The IUPAC name of 6,6-difluoro-1,4-diazepane;hydrochloride (CID 169219655) is 6,6-difluoro-1,4-diazepane;hydrochloride.
What is the SMILES notation for 6,6-difluoro-1,4-diazepane;hydrochloride?
The canonical SMILES for 6,6-difluoro-1,4-diazepane;hydrochloride is Cl.FC1(F)CNCCNC1.
What is the InChIKey of 6,6-difluoro-1,4-diazepane;hydrochloride?
The InChIKey is WIUTXWOJBSKFLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10F2N2.ClH/c6-5(7)3-8-1-2-9-4-5;/h8-9H,1-4H2;1H.
What are the key properties of 6,6-difluoro-1,4-diazepane;hydrochloride?
6,6-difluoro-1,4-diazepane;hydrochloride has a molecular weight of 172.61 g/mol, XLogP of 0.24, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-difluoro-1,4-diazepane;hydrochloride is sourced from PubChem (CID 169219655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).