C31H38N4O6S — CID 169220465
5-[(11R)-6-(2,6-dimethylphenyl)-11-(2,2-dimethylpropyl)-2,2,13-trioxo-9-oxa-2λ6-thia-3,5,12,19-tetrazatricyclo[12.3.1.14,8]nonadeca-1(17),4,6,8(19),14(18),15-hexaen-12-yl]pentanoic acid (PubChem CID 169220465) has the molecular formula C31H38N4O6S and a molecular weight of 594.73 g/mol. Its IUPAC name is 5-[(11R)-6-(2,6-dimethylphenyl)-11-(2,2-dimethylpropyl)-2,2,13-trioxo-9-oxa-2λ6-thia-3,5,12,19-tetrazatricyclo[12.3.1.14,8]nonadeca-1(17),4,6,8(19),14(18),15-hexaen-12-yl]pentanoic acid.
| Compound Name | 5-[(11R)-6-(2,6-dimethylphenyl)-11-(2,2-dimethylpropyl)-2,2,13-trioxo-9-oxa-2λ6-thia-3,5,12,19-tetrazatricyclo[12.3.1.14,8]nonadeca-1(17),4,6,8(19),14(18),15-hexaen-12-yl]pentanoic acid |
|---|---|
| PubChem CID | 169220465 |
| Molecular Formula | C31H38N4O6S |
| Molecular Weight | 594.73 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | 5-[(11R)-6-(2,6-dimethylphenyl)-11-(2,2-dimethylpropyl)-2,2,13-trioxo-9-oxa-2λ6-thia-3,5,12,19-tetrazatricyclo[12.3.1.14,8]nonadeca-1(17),4,6,8(19),14(18),15-hexaen-12-yl]pentanoic acid |
| SMILES | Cc1cccc(C)c1-c1cc2nc(n1)NS(=O)(=O)c1cccc(c1)C(=O)N(CCCCC(=O)O)[C@H](CC(C)(C)C)CO2 |
| InChI | InChI=1S/C31H38N4O6S/c1-20-10-8-11-21(2)28(20)25-17-26-33-30(32-25)34-42(39,40)24-13-9-12-22(16-24)29(38)35(15-7-6-14-27(36)37)23(19-41-26)18-31(3,4)5/h8-13,16-17,23H,6-7,14-15,18-19H2,1-5H3,(H,36,37)(H,32,33,34)/t23-/m1/s1 |
| InChIKey | FMOFCLNRRALORV-HSZRJFAPSA-N |
| XLogP | 5.46 |
| TPSA | 138.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.73 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|