About [(3R,6S)-6-(methanesulfonamidomethyl)oxan-3-yl]azanium chloride
[(3R,6S)-6-(methanesulfonamidomethyl)oxan-3-yl]azanium chloride (PubChem CID 169220630) has the molecular formula C7H17ClN2O3S
and a molecular weight of 244.74 g/mol. Its IUPAC name is [(3R,6S)-6-(methanesulfonamidomethyl)oxan-3-yl]azanium chloride.
Molecular Properties
| Compound Name | [(3R,6S)-6-(methanesulfonamidomethyl)oxan-3-yl]azanium chloride |
| PubChem CID | 169220630 |
| Molecular Formula | C7H17ClN2O3S |
| Molecular Weight | 244.74 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | [(3R,6S)-6-(methanesulfonamidomethyl)oxan-3-yl]azanium chloride |
| SMILES | CS(=O)(=O)NC[C@@H]1CC[C@@H]([NH3+])CO1.[Cl-] |
| InChI | InChI=1S/C7H16N2O3S.ClH/c1-13(10,11)9-4-7-3-2-6(8)5-12-7;/h6-7,9H,2-5,8H2,1H3;1H/t6-,7+;/m1./s1 |
| InChIKey | KVLXFLTXPXXPBU-HHQFNNIRSA-N |
| XLogP | -4.67 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.74 |
| LogP ≤ 5 | -4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R,6S)-6-(methanesulfonamidomethyl)oxan-3-yl]azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,6S)-6-(methanesulfonamidomethyl)oxan-3-yl]azanium chloride?
The IUPAC name of [(3R,6S)-6-(methanesulfonamidomethyl)oxan-3-yl]azanium chloride (CID 169220630) is [(3R,6S)-6-(methanesulfonamidomethyl)oxan-3-yl]azanium chloride.
What is the SMILES notation for [(3R,6S)-6-(methanesulfonamidomethyl)oxan-3-yl]azanium chloride?
The canonical SMILES for [(3R,6S)-6-(methanesulfonamidomethyl)oxan-3-yl]azanium chloride is CS(=O)(=O)NC[C@@H]1CC[C@@H]([NH3+])CO1.[Cl-].
What is the InChIKey of [(3R,6S)-6-(methanesulfonamidomethyl)oxan-3-yl]azanium chloride?
The InChIKey is KVLXFLTXPXXPBU-HHQFNNIRSA-N. The full InChI is InChI=1S/C7H16N2O3S.ClH/c1-13(10,11)9-4-7-3-2-6(8)5-12-7;/h6-7,9H,2-5,8H2,1H3;1H/t6-,7+;/m1./s1.
What are the key properties of [(3R,6S)-6-(methanesulfonamidomethyl)oxan-3-yl]azanium chloride?
[(3R,6S)-6-(methanesulfonamidomethyl)oxan-3-yl]azanium chloride has a molecular weight of 244.74 g/mol, XLogP of -4.67, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,6S)-6-(methanesulfonamidomethyl)oxan-3-yl]azanium chloride is sourced from PubChem (CID 169220630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).