About 6-chloro-N-(3,4-difluorophenyl)-1H-pyrrolo[2,3-b]pyridin-5-amine
6-chloro-N-(3,4-difluorophenyl)-1H-pyrrolo[2,3-b]pyridin-5-amine (PubChem CID 169220634) has the molecular formula C13H8ClF2N3
and a molecular weight of 279.68 g/mol. Its IUPAC name is 6-chloro-N-(3,4-difluorophenyl)-1H-pyrrolo[2,3-b]pyridin-5-amine.
Molecular Properties
| Compound Name | 6-chloro-N-(3,4-difluorophenyl)-1H-pyrrolo[2,3-b]pyridin-5-amine |
| PubChem CID | 169220634 |
| Molecular Formula | C13H8ClF2N3 |
| Molecular Weight | 279.68 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 6-chloro-N-(3,4-difluorophenyl)-1H-pyrrolo[2,3-b]pyridin-5-amine |
| SMILES | Fc1ccc(Nc2cc3cc[nH]c3nc2Cl)cc1F |
| InChI | InChI=1S/C13H8ClF2N3/c14-12-11(5-7-3-4-17-13(7)19-12)18-8-1-2-9(15)10(16)6-8/h1-6,18H,(H,17,19) |
| InChIKey | BHTPGIQAGXZEHZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.68 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N-(3,4-difluorophenyl)-1H-pyrrolo[2,3-b]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-(3,4-difluorophenyl)-1H-pyrrolo[2,3-b]pyridin-5-amine?
The IUPAC name of 6-chloro-N-(3,4-difluorophenyl)-1H-pyrrolo[2,3-b]pyridin-5-amine (CID 169220634) is 6-chloro-N-(3,4-difluorophenyl)-1H-pyrrolo[2,3-b]pyridin-5-amine.
What is the SMILES notation for 6-chloro-N-(3,4-difluorophenyl)-1H-pyrrolo[2,3-b]pyridin-5-amine?
The canonical SMILES for 6-chloro-N-(3,4-difluorophenyl)-1H-pyrrolo[2,3-b]pyridin-5-amine is Fc1ccc(Nc2cc3cc[nH]c3nc2Cl)cc1F.
What is the InChIKey of 6-chloro-N-(3,4-difluorophenyl)-1H-pyrrolo[2,3-b]pyridin-5-amine?
The InChIKey is BHTPGIQAGXZEHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClF2N3/c14-12-11(5-7-3-4-17-13(7)19-12)18-8-1-2-9(15)10(16)6-8/h1-6,18H,(H,17,19).
What are the key properties of 6-chloro-N-(3,4-difluorophenyl)-1H-pyrrolo[2,3-b]pyridin-5-amine?
6-chloro-N-(3,4-difluorophenyl)-1H-pyrrolo[2,3-b]pyridin-5-amine has a molecular weight of 279.68 g/mol, XLogP of 4.24, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-(3,4-difluorophenyl)-1H-pyrrolo[2,3-b]pyridin-5-amine is sourced from PubChem (CID 169220634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).