C13H11BrF3N3O2S — CID 169220862
N-(6-bromo-5-methyl-2-pyridinyl)-1-[4-(trifluoromethyl)-2-pyridinyl]methanesulfonamide (PubChem CID 169220862) has the molecular formula C13H11BrF3N3O2S and a molecular weight of 410.22 g/mol. Its IUPAC name is N-(6-bromo-5-methyl-2-pyridinyl)-1-[4-(trifluoromethyl)-2-pyridinyl]methanesulfonamide.
| Compound Name | N-(6-bromo-5-methyl-2-pyridinyl)-1-[4-(trifluoromethyl)-2-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 169220862 |
| Molecular Formula | C13H11BrF3N3O2S |
| Molecular Weight | 410.22 g/mol |
| Exact Mass | 408.97 |
| IUPAC Name | N-(6-bromo-5-methyl-2-pyridinyl)-1-[4-(trifluoromethyl)-2-pyridinyl]methanesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)Cc2cc(C(F)(F)F)ccn2)nc1Br |
| InChI | InChI=1S/C13H11BrF3N3O2S/c1-8-2-3-11(19-12(8)14)20-23(21,22)7-10-6-9(4-5-18-10)13(15,16)17/h2-6H,7H2,1H3,(H,19,20) |
| InChIKey | MNXUFLNFLXGUGY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.22 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|