C10H11BrN2O4S — CID 169221110
N-[(5-bromo-2-nitrophenyl)methyl]cyclopropanesulfonamide (PubChem CID 169221110) has the molecular formula C10H11BrN2O4S and a molecular weight of 335.18 g/mol. Its IUPAC name is N-[(5-bromo-2-nitrophenyl)methyl]cyclopropanesulfonamide.
| Compound Name | N-[(5-bromo-2-nitrophenyl)methyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 169221110 |
| Molecular Formula | C10H11BrN2O4S |
| Molecular Weight | 335.18 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | N-[(5-bromo-2-nitrophenyl)methyl]cyclopropanesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(Br)cc1CNS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C10H11BrN2O4S/c11-8-1-4-10(13(14)15)7(5-8)6-12-18(16,17)9-2-3-9/h1,4-5,9,12H,2-3,6H2 |
| InChIKey | XWWQFNTVSZYRNG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.18 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|