C13H14N4O2 — CID 169221732
2,2-bis(2-amino-3-pyridinyl)propanoic acid (PubChem CID 169221732) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is 2,2-bis(2-amino-3-pyridinyl)propanoic acid.
| Compound Name | 2,2-bis(2-amino-3-pyridinyl)propanoic acid |
|---|---|
| PubChem CID | 169221732 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 2,2-bis(2-amino-3-pyridinyl)propanoic acid |
| SMILES | CC(C(=O)O)(c1cccnc1N)c1cccnc1N |
| InChI | InChI=1S/C13H14N4O2/c1-13(12(18)19,8-4-2-6-16-10(8)14)9-5-3-7-17-11(9)15/h2-7H,1H3,(H2,14,16)(H2,15,17)(H,18,19) |
| InChIKey | BJCAYRVSCXNLJM-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |