C22H25FN6O3S — CID 169222683
(6R)-1-(5-fluoro-2-pyridinyl)-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-(2-methylpyrazol-3-yl)-4,5,6,7-tetrahydroindazole-6-carboxamide (PubChem CID 169222683) has the molecular formula C22H25FN6O3S and a molecular weight of 472.55 g/mol. Its IUPAC name is (6R)-1-(5-fluoro-2-pyridinyl)-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-(2-methylpyrazol-3-yl)-4,5,6,7-tetrahydroindazole-6-carboxamide.
| Compound Name | (6R)-1-(5-fluoro-2-pyridinyl)-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-(2-methylpyrazol-3-yl)-4,5,6,7-tetrahydroindazole-6-carboxamide |
|---|---|
| PubChem CID | 169222683 |
| Molecular Formula | C22H25FN6O3S |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | (6R)-1-(5-fluoro-2-pyridinyl)-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-(2-methylpyrazol-3-yl)-4,5,6,7-tetrahydroindazole-6-carboxamide |
| SMILES | Cn1nccc1-c1nn(-c2ccc(F)cn2)c2c1CC[C@@H](C(=O)N[C@@]1(C)CCS(=O)(=O)C1)C2 |
| InChI | InChI=1S/C22H25FN6O3S/c1-22(8-10-33(31,32)13-22)26-21(30)14-3-5-16-18(11-14)29(19-6-4-15(23)12-24-19)27-20(16)17-7-9-25-28(17)2/h4,6-7,9,12,14H,3,5,8,10-11,13H2,1-2H3,(H,26,30)/t14-,22+/m1/s1 |
| InChIKey | OKBFVKKKMJGXKB-PEBXRYMYSA-N |
| XLogP | 1.61 |
| TPSA | 111.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |