C23H29F2N3O3S — CID 169222690
(6R)-3-[3-(1,1-difluoroethyl)phenyl]-N-(3-methyl-1,1-dioxothietan-3-yl)-1-propan-2-yl-4,5,6,7-tetrahydroindazole-6-carboxamide (PubChem CID 169222690) has the molecular formula C23H29F2N3O3S and a molecular weight of 465.57 g/mol. Its IUPAC name is (6R)-3-[3-(1,1-difluoroethyl)phenyl]-N-(3-methyl-1,1-dioxothietan-3-yl)-1-propan-2-yl-4,5,6,7-tetrahydroindazole-6-carboxamide.
| Compound Name | (6R)-3-[3-(1,1-difluoroethyl)phenyl]-N-(3-methyl-1,1-dioxothietan-3-yl)-1-propan-2-yl-4,5,6,7-tetrahydroindazole-6-carboxamide |
|---|---|
| PubChem CID | 169222690 |
| Molecular Formula | C23H29F2N3O3S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | (6R)-3-[3-(1,1-difluoroethyl)phenyl]-N-(3-methyl-1,1-dioxothietan-3-yl)-1-propan-2-yl-4,5,6,7-tetrahydroindazole-6-carboxamide |
| SMILES | CC(C)n1nc(-c2cccc(C(C)(F)F)c2)c2c1C[C@H](C(=O)NC1(C)CS(=O)(=O)C1)CC2 |
| InChI | InChI=1S/C23H29F2N3O3S/c1-14(2)28-19-11-16(21(29)26-22(3)12-32(30,31)13-22)8-9-18(19)20(27-28)15-6-5-7-17(10-15)23(4,24)25/h5-7,10,14,16H,8-9,11-13H2,1-4H3,(H,26,29)/t16-/m1/s1 |
| InChIKey | UWMGUXUUTNCLEO-MRXNPFEDSA-N |
| XLogP | 3.65 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |