C22H19F2N5O2S — CID 169223189
1-[(1R)-1-[4-[2-(3,3-difluoroazetidin-1-yl)-3-pyridinyl]phenyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea (PubChem CID 169223189) has the molecular formula C22H19F2N5O2S and a molecular weight of 455.49 g/mol. Its IUPAC name is 1-[(1R)-1-[4-[2-(3,3-difluoroazetidin-1-yl)-3-pyridinyl]phenyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea.
| Compound Name | 1-[(1R)-1-[4-[2-(3,3-difluoroazetidin-1-yl)-3-pyridinyl]phenyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea |
|---|---|
| PubChem CID | 169223189 |
| Molecular Formula | C22H19F2N5O2S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 1-[(1R)-1-[4-[2-(3,3-difluoroazetidin-1-yl)-3-pyridinyl]phenyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea |
| SMILES | C#Cc1nc(NC(=O)N[C@@H](CO)c2ccc(-c3cccnc3N3CC(F)(F)C3)cc2)cs1 |
| InChI | InChI=1S/C22H19F2N5O2S/c1-2-19-27-18(11-32-19)28-21(31)26-17(10-30)15-7-5-14(6-8-15)16-4-3-9-25-20(16)29-12-22(23,24)13-29/h1,3-9,11,17,30H,10,12-13H2,(H2,26,28,31)/t17-/m0/s1 |
| InChIKey | YGXWJWYZAGXWGB-KRWDZBQOSA-N |
| XLogP | 3.50 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|