About 4-chloro-2,4-dihydro-1H-pyridazin-3-one
4-chloro-2,4-dihydro-1H-pyridazin-3-one (PubChem CID 169223995) has the molecular formula C4H5ClN2O
and a molecular weight of 132.55 g/mol. Its IUPAC name is 4-chloro-2,4-dihydro-1H-pyridazin-3-one.
Molecular Properties
| Compound Name | 4-chloro-2,4-dihydro-1H-pyridazin-3-one |
| PubChem CID | 169223995 |
| Molecular Formula | C4H5ClN2O |
| Molecular Weight | 132.55 g/mol |
| Exact Mass | 132.01 |
| IUPAC Name | 4-chloro-2,4-dihydro-1H-pyridazin-3-one |
| SMILES | O=C1NNC=CC1Cl |
| InChI | InChI=1S/C4H5ClN2O/c5-3-1-2-6-7-4(3)8/h1-3,6H,(H,7,8) |
| InChIKey | HNPHXYMYYBHOIC-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.55 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2,4-dihydro-1H-pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2,4-dihydro-1H-pyridazin-3-one?
The IUPAC name of 4-chloro-2,4-dihydro-1H-pyridazin-3-one (CID 169223995) is 4-chloro-2,4-dihydro-1H-pyridazin-3-one.
What is the SMILES notation for 4-chloro-2,4-dihydro-1H-pyridazin-3-one?
The canonical SMILES for 4-chloro-2,4-dihydro-1H-pyridazin-3-one is O=C1NNC=CC1Cl.
What is the InChIKey of 4-chloro-2,4-dihydro-1H-pyridazin-3-one?
The InChIKey is HNPHXYMYYBHOIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5ClN2O/c5-3-1-2-6-7-4(3)8/h1-3,6H,(H,7,8).
What are the key properties of 4-chloro-2,4-dihydro-1H-pyridazin-3-one?
4-chloro-2,4-dihydro-1H-pyridazin-3-one has a molecular weight of 132.55 g/mol, XLogP of -0.26, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,4-dihydro-1H-pyridazin-3-one is sourced from PubChem (CID 169223995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).