About [2-(methoxymethylamino)-2-oxoethyl] azetidine-1-carboxylate
[2-(methoxymethylamino)-2-oxoethyl] azetidine-1-carboxylate (PubChem CID 169224077) has the molecular formula C8H14N2O4
and a molecular weight of 202.21 g/mol. Its IUPAC name is [2-(methoxymethylamino)-2-oxoethyl] azetidine-1-carboxylate.
Molecular Properties
| Compound Name | [2-(methoxymethylamino)-2-oxoethyl] azetidine-1-carboxylate |
| PubChem CID | 169224077 |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | [2-(methoxymethylamino)-2-oxoethyl] azetidine-1-carboxylate |
| SMILES | COCNC(=O)COC(=O)N1CCC1 |
| InChI | InChI=1S/C8H14N2O4/c1-13-6-9-7(11)5-14-8(12)10-3-2-4-10/h2-6H2,1H3,(H,9,11) |
| InChIKey | RNMCGIKPYXOXGQ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [2-(methoxymethylamino)-2-oxoethyl] azetidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(methoxymethylamino)-2-oxoethyl] azetidine-1-carboxylate?
The IUPAC name of [2-(methoxymethylamino)-2-oxoethyl] azetidine-1-carboxylate (CID 169224077) is [2-(methoxymethylamino)-2-oxoethyl] azetidine-1-carboxylate.
What is the SMILES notation for [2-(methoxymethylamino)-2-oxoethyl] azetidine-1-carboxylate?
The canonical SMILES for [2-(methoxymethylamino)-2-oxoethyl] azetidine-1-carboxylate is COCNC(=O)COC(=O)N1CCC1.
What is the InChIKey of [2-(methoxymethylamino)-2-oxoethyl] azetidine-1-carboxylate?
The InChIKey is RNMCGIKPYXOXGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O4/c1-13-6-9-7(11)5-14-8(12)10-3-2-4-10/h2-6H2,1H3,(H,9,11).
What are the key properties of [2-(methoxymethylamino)-2-oxoethyl] azetidine-1-carboxylate?
[2-(methoxymethylamino)-2-oxoethyl] azetidine-1-carboxylate has a molecular weight of 202.21 g/mol, XLogP of -0.45, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(methoxymethylamino)-2-oxoethyl] azetidine-1-carboxylate is sourced from PubChem (CID 169224077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).