About 3,6-bis[(2,6-difluorophenyl)methyl]-4-methyl-5-methylsulfanylpyridazine
3,6-bis[(2,6-difluorophenyl)methyl]-4-methyl-5-methylsulfanylpyridazine (PubChem CID 169224869) has the molecular formula C20H16F4N2S
and a molecular weight of 392.42 g/mol. Its IUPAC name is 3,6-bis[(2,6-difluorophenyl)methyl]-4-methyl-5-methylsulfanylpyridazine.
Molecular Properties
| Compound Name | 3,6-bis[(2,6-difluorophenyl)methyl]-4-methyl-5-methylsulfanylpyridazine |
| PubChem CID | 169224869 |
| Molecular Formula | C20H16F4N2S |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 3,6-bis[(2,6-difluorophenyl)methyl]-4-methyl-5-methylsulfanylpyridazine |
| SMILES | CSc1c(Cc2c(F)cccc2F)nnc(Cc2c(F)cccc2F)c1C |
| InChI | InChI=1S/C20H16F4N2S/c1-11-18(9-12-14(21)5-3-6-15(12)22)25-26-19(20(11)27-2)10-13-16(23)7-4-8-17(13)24/h3-8H,9-10H2,1-2H3 |
| InChIKey | HCCJIZUYJYVDAC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,6-bis[(2,6-difluorophenyl)methyl]-4-methyl-5-methylsulfanylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-bis[(2,6-difluorophenyl)methyl]-4-methyl-5-methylsulfanylpyridazine?
The IUPAC name of 3,6-bis[(2,6-difluorophenyl)methyl]-4-methyl-5-methylsulfanylpyridazine (CID 169224869) is 3,6-bis[(2,6-difluorophenyl)methyl]-4-methyl-5-methylsulfanylpyridazine.
What is the SMILES notation for 3,6-bis[(2,6-difluorophenyl)methyl]-4-methyl-5-methylsulfanylpyridazine?
The canonical SMILES for 3,6-bis[(2,6-difluorophenyl)methyl]-4-methyl-5-methylsulfanylpyridazine is CSc1c(Cc2c(F)cccc2F)nnc(Cc2c(F)cccc2F)c1C.
What is the InChIKey of 3,6-bis[(2,6-difluorophenyl)methyl]-4-methyl-5-methylsulfanylpyridazine?
The InChIKey is HCCJIZUYJYVDAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16F4N2S/c1-11-18(9-12-14(21)5-3-6-15(12)22)25-26-19(20(11)27-2)10-13-16(23)7-4-8-17(13)24/h3-8H,9-10H2,1-2H3.
What are the key properties of 3,6-bis[(2,6-difluorophenyl)methyl]-4-methyl-5-methylsulfanylpyridazine?
3,6-bis[(2,6-difluorophenyl)methyl]-4-methyl-5-methylsulfanylpyridazine has a molecular weight of 392.42 g/mol, XLogP of 5.24, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-bis[(2,6-difluorophenyl)methyl]-4-methyl-5-methylsulfanylpyridazine is sourced from PubChem (CID 169224869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).