C23H31NOSi — CID 169225382
tert-butyl-[[(2S,8R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl]oxy]-diphenylsilane (PubChem CID 169225382) has the molecular formula C23H31NOSi and a molecular weight of 365.59 g/mol. Its IUPAC name is tert-butyl-[[(2S,8R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl]oxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2S,8R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl]oxy]-diphenylsilane |
|---|---|
| PubChem CID | 169225382 |
| Molecular Formula | C23H31NOSi |
| Molecular Weight | 365.59 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | tert-butyl-[[(2S,8R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl]oxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](O[C@H]1C[C@H]2CCCN2C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31NOSi/c1-23(2,3)26(21-12-6-4-7-13-21,22-14-8-5-9-15-22)25-20-17-19-11-10-16-24(19)18-20/h4-9,12-15,19-20H,10-11,16-18H2,1-3H3/t19-,20+/m1/s1 |
| InChIKey | KBLVSYQIGWKRAB-UXHICEINSA-N |
| XLogP | 3.80 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.59 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|