About 5-bromo-4-(2,2-difluoroethoxy)-6-methoxypyrimidin-2-amine
5-bromo-4-(2,2-difluoroethoxy)-6-methoxypyrimidin-2-amine (PubChem CID 169225705) has the molecular formula C7H8BrF2N3O2
and a molecular weight of 284.06 g/mol. Its IUPAC name is 5-bromo-4-(2,2-difluoroethoxy)-6-methoxypyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-bromo-4-(2,2-difluoroethoxy)-6-methoxypyrimidin-2-amine |
| PubChem CID | 169225705 |
| Molecular Formula | C7H8BrF2N3O2 |
| Molecular Weight | 284.06 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 5-bromo-4-(2,2-difluoroethoxy)-6-methoxypyrimidin-2-amine |
| SMILES | COc1nc(N)nc(OCC(F)F)c1Br |
| InChI | InChI=1S/C7H8BrF2N3O2/c1-14-5-4(8)6(13-7(11)12-5)15-2-3(9)10/h3H,2H2,1H3,(H2,11,12,13) |
| InChIKey | GKHOYTWTNDDDPE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.06 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-4-(2,2-difluoroethoxy)-6-methoxypyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-(2,2-difluoroethoxy)-6-methoxypyrimidin-2-amine?
The IUPAC name of 5-bromo-4-(2,2-difluoroethoxy)-6-methoxypyrimidin-2-amine (CID 169225705) is 5-bromo-4-(2,2-difluoroethoxy)-6-methoxypyrimidin-2-amine.
What is the SMILES notation for 5-bromo-4-(2,2-difluoroethoxy)-6-methoxypyrimidin-2-amine?
The canonical SMILES for 5-bromo-4-(2,2-difluoroethoxy)-6-methoxypyrimidin-2-amine is COc1nc(N)nc(OCC(F)F)c1Br.
What is the InChIKey of 5-bromo-4-(2,2-difluoroethoxy)-6-methoxypyrimidin-2-amine?
The InChIKey is GKHOYTWTNDDDPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrF2N3O2/c1-14-5-4(8)6(13-7(11)12-5)15-2-3(9)10/h3H,2H2,1H3,(H2,11,12,13).
What are the key properties of 5-bromo-4-(2,2-difluoroethoxy)-6-methoxypyrimidin-2-amine?
5-bromo-4-(2,2-difluoroethoxy)-6-methoxypyrimidin-2-amine has a molecular weight of 284.06 g/mol, XLogP of 1.47, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-(2,2-difluoroethoxy)-6-methoxypyrimidin-2-amine is sourced from PubChem (CID 169225705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).