C8H15NO6 — CID 169225729
2-amino-2-(2-ethoxyethoxymethyl)propanedioic acid (PubChem CID 169225729) has the molecular formula C8H15NO6 and a molecular weight of 221.21 g/mol. Its IUPAC name is 2-amino-2-(2-ethoxyethoxymethyl)propanedioic acid.
| Compound Name | 2-amino-2-(2-ethoxyethoxymethyl)propanedioic acid |
|---|---|
| PubChem CID | 169225729 |
| Molecular Formula | C8H15NO6 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 2-amino-2-(2-ethoxyethoxymethyl)propanedioic acid |
| SMILES | CCOCCOCC(N)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H15NO6/c1-2-14-3-4-15-5-8(9,6(10)11)7(12)13/h2-5,9H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | VZDBVFWYFXZLOH-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|