C16H22ClN6O2S- — CID 169226276
7-chloro-5-methyl-4-[6-[propylamino(sulfinato)amino]-2-azaspiro[3.3]heptan-2-yl]pyrrolo[2,1-f][1,2,4]triazine (PubChem CID 169226276) has the molecular formula C16H22ClN6O2S- and a molecular weight of 397.91 g/mol. Its IUPAC name is 7-chloro-5-methyl-4-[6-[propylamino(sulfinato)amino]-2-azaspiro[3.3]heptan-2-yl]pyrrolo[2,1-f][1,2,4]triazine.
| Compound Name | 7-chloro-5-methyl-4-[6-[propylamino(sulfinato)amino]-2-azaspiro[3.3]heptan-2-yl]pyrrolo[2,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 169226276 |
| Molecular Formula | C16H22ClN6O2S- |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 7-chloro-5-methyl-4-[6-[propylamino(sulfinato)amino]-2-azaspiro[3.3]heptan-2-yl]pyrrolo[2,1-f][1,2,4]triazine |
| SMILES | CCCNN(C1CC2(C1)CN(c1ncnn3c(Cl)cc(C)c13)C2)S(=O)[O-] |
| InChI | InChI=1S/C16H23ClN6O2S/c1-3-4-19-23(26(24)25)12-6-16(7-12)8-21(9-16)15-14-11(2)5-13(17)22(14)20-10-18-15/h5,10,12,19H,3-4,6-9H2,1-2H3,(H,24,25)/p-1 |
| InChIKey | IPVCAJCTWHIOOE-UHFFFAOYSA-M |
| XLogP | 1.67 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|