C16H19FINO2 — CID 169228068
methyl 5-(4-fluorophenyl)-6-iodo-5-methyl-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate (PubChem CID 169228068) has the molecular formula C16H19FINO2 and a molecular weight of 403.24 g/mol. Its IUPAC name is methyl 5-(4-fluorophenyl)-6-iodo-5-methyl-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate.
| Compound Name | methyl 5-(4-fluorophenyl)-6-iodo-5-methyl-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate |
|---|---|
| PubChem CID | 169228068 |
| Molecular Formula | C16H19FINO2 |
| Molecular Weight | 403.24 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | methyl 5-(4-fluorophenyl)-6-iodo-5-methyl-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate |
| SMILES | COC(=O)C12CCCN1C(C)(c1ccc(F)cc1)C(I)C2 |
| InChI | InChI=1S/C16H19FINO2/c1-15(11-4-6-12(17)7-5-11)13(18)10-16(14(20)21-2)8-3-9-19(15)16/h4-7,13H,3,8-10H2,1-2H3 |
| InChIKey | BHQZWPWTANTVIH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.24 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|