About 4-chloro-N-[(3R,5R)-1-cyclopropyl-5-fluoropiperidin-3-yl]phthalazin-1-amine
4-chloro-N-[(3R,5R)-1-cyclopropyl-5-fluoropiperidin-3-yl]phthalazin-1-amine (PubChem CID 169230329) has the molecular formula C16H18ClFN4
and a molecular weight of 320.80 g/mol. Its IUPAC name is 4-chloro-N-[(3R,5R)-1-cyclopropyl-5-fluoropiperidin-3-yl]phthalazin-1-amine.
Molecular Properties
| Compound Name | 4-chloro-N-[(3R,5R)-1-cyclopropyl-5-fluoropiperidin-3-yl]phthalazin-1-amine |
| PubChem CID | 169230329 |
| Molecular Formula | C16H18ClFN4 |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 4-chloro-N-[(3R,5R)-1-cyclopropyl-5-fluoropiperidin-3-yl]phthalazin-1-amine |
| SMILES | F[C@@H]1C[C@@H](Nc2nnc(Cl)c3ccccc23)CN(C2CC2)C1 |
| InChI | InChI=1S/C16H18ClFN4/c17-15-13-3-1-2-4-14(13)16(21-20-15)19-11-7-10(18)8-22(9-11)12-5-6-12/h1-4,10-12H,5-9H2,(H,19,21)/t10-,11-/m1/s1 |
| InChIKey | XMGSGRZKRNAQPW-GHMZBOCLSA-N |
| XLogP | 3.27 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-N-[(3R,5R)-1-cyclopropyl-5-fluoropiperidin-3-yl]phthalazin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[(3R,5R)-1-cyclopropyl-5-fluoropiperidin-3-yl]phthalazin-1-amine?
The IUPAC name of 4-chloro-N-[(3R,5R)-1-cyclopropyl-5-fluoropiperidin-3-yl]phthalazin-1-amine (CID 169230329) is 4-chloro-N-[(3R,5R)-1-cyclopropyl-5-fluoropiperidin-3-yl]phthalazin-1-amine.
What is the SMILES notation for 4-chloro-N-[(3R,5R)-1-cyclopropyl-5-fluoropiperidin-3-yl]phthalazin-1-amine?
The canonical SMILES for 4-chloro-N-[(3R,5R)-1-cyclopropyl-5-fluoropiperidin-3-yl]phthalazin-1-amine is F[C@@H]1C[C@@H](Nc2nnc(Cl)c3ccccc23)CN(C2CC2)C1.
What is the InChIKey of 4-chloro-N-[(3R,5R)-1-cyclopropyl-5-fluoropiperidin-3-yl]phthalazin-1-amine?
The InChIKey is XMGSGRZKRNAQPW-GHMZBOCLSA-N. The full InChI is InChI=1S/C16H18ClFN4/c17-15-13-3-1-2-4-14(13)16(21-20-15)19-11-7-10(18)8-22(9-11)12-5-6-12/h1-4,10-12H,5-9H2,(H,19,21)/t10-,11-/m1/s1.
What are the key properties of 4-chloro-N-[(3R,5R)-1-cyclopropyl-5-fluoropiperidin-3-yl]phthalazin-1-amine?
4-chloro-N-[(3R,5R)-1-cyclopropyl-5-fluoropiperidin-3-yl]phthalazin-1-amine has a molecular weight of 320.80 g/mol, XLogP of 3.27, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[(3R,5R)-1-cyclopropyl-5-fluoropiperidin-3-yl]phthalazin-1-amine is sourced from PubChem (CID 169230329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).