C26H26FN6O+ — CID 169231242
[(Z)-2-[4-[3-(2-fluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]quinazolin-7-yl]-3-iminoprop-1-enyl]-methylazanium (PubChem CID 169231242) has the molecular formula C26H26FN6O+ and a molecular weight of 457.53 g/mol. Its IUPAC name is [(Z)-2-[4-[3-(2-fluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]quinazolin-7-yl]-3-iminoprop-1-enyl]-methylazanium.
| Compound Name | [(Z)-2-[4-[3-(2-fluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]quinazolin-7-yl]-3-iminoprop-1-enyl]-methylazanium |
|---|---|
| PubChem CID | 169231242 |
| Molecular Formula | C26H26FN6O+ |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | [(Z)-2-[4-[3-(2-fluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]quinazolin-7-yl]-3-iminoprop-1-enyl]-methylazanium |
| SMILES | [H]/N=C/C(=C\[NH2+]C)c1ccc2c(-c3cn(C4CCCCO4)nc3-c3ccccc3F)ncnc2c1 |
| InChI | InChI=1S/C26H25FN6O/c1-29-14-18(13-28)17-9-10-20-23(12-17)30-16-31-25(20)21-15-33(24-8-4-5-11-34-24)32-26(21)19-6-2-3-7-22(19)27/h2-3,6-7,9-10,12-16,24,28-29H,4-5,8,11H2,1H3/p+1/b18-14+,28-13+ |
| InChIKey | XMSCKZBBKUYPQG-YFIGMEBMSA-O |
| XLogP | 4.18 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|