About 4-[4-[1-(2,2-difluoroethyl)-3-phenylpyrazol-4-yl]-7-methoxyquinazolin-6-yl]oxan-4-ol
4-[4-[1-(2,2-difluoroethyl)-3-phenylpyrazol-4-yl]-7-methoxyquinazolin-6-yl]oxan-4-ol (PubChem CID 169231517) has the molecular formula C25H24F2N4O3
and a molecular weight of 466.49 g/mol. Its IUPAC name is 4-[4-[1-(2,2-difluoroethyl)-3-phenylpyrazol-4-yl]-7-methoxyquinazolin-6-yl]oxan-4-ol.
Molecular Properties
| Compound Name | 4-[4-[1-(2,2-difluoroethyl)-3-phenylpyrazol-4-yl]-7-methoxyquinazolin-6-yl]oxan-4-ol |
| PubChem CID | 169231517 |
| Molecular Formula | C25H24F2N4O3 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 4-[4-[1-(2,2-difluoroethyl)-3-phenylpyrazol-4-yl]-7-methoxyquinazolin-6-yl]oxan-4-ol |
| SMILES | COc1cc2ncnc(-c3cn(CC(F)F)nc3-c3ccccc3)c2cc1C1(O)CCOCC1 |
| InChI | InChI=1S/C25H24F2N4O3/c1-33-21-12-20-17(11-19(21)25(32)7-9-34-10-8-25)24(29-15-28-20)18-13-31(14-22(26)27)30-23(18)16-5-3-2-4-6-16/h2-6,11-13,15,22,32H,7-10,14H2,1H3 |
| InChIKey | WZFRLPUVYJWXAV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[4-[1-(2,2-difluoroethyl)-3-phenylpyrazol-4-yl]-7-methoxyquinazolin-6-yl]oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[1-(2,2-difluoroethyl)-3-phenylpyrazol-4-yl]-7-methoxyquinazolin-6-yl]oxan-4-ol?
The IUPAC name of 4-[4-[1-(2,2-difluoroethyl)-3-phenylpyrazol-4-yl]-7-methoxyquinazolin-6-yl]oxan-4-ol (CID 169231517) is 4-[4-[1-(2,2-difluoroethyl)-3-phenylpyrazol-4-yl]-7-methoxyquinazolin-6-yl]oxan-4-ol.
What is the SMILES notation for 4-[4-[1-(2,2-difluoroethyl)-3-phenylpyrazol-4-yl]-7-methoxyquinazolin-6-yl]oxan-4-ol?
The canonical SMILES for 4-[4-[1-(2,2-difluoroethyl)-3-phenylpyrazol-4-yl]-7-methoxyquinazolin-6-yl]oxan-4-ol is COc1cc2ncnc(-c3cn(CC(F)F)nc3-c3ccccc3)c2cc1C1(O)CCOCC1.
What is the InChIKey of 4-[4-[1-(2,2-difluoroethyl)-3-phenylpyrazol-4-yl]-7-methoxyquinazolin-6-yl]oxan-4-ol?
The InChIKey is WZFRLPUVYJWXAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24F2N4O3/c1-33-21-12-20-17(11-19(21)25(32)7-9-34-10-8-25)24(29-15-28-20)18-13-31(14-22(26)27)30-23(18)16-5-3-2-4-6-16/h2-6,11-13,15,22,32H,7-10,14H2,1H3.
What are the key properties of 4-[4-[1-(2,2-difluoroethyl)-3-phenylpyrazol-4-yl]-7-methoxyquinazolin-6-yl]oxan-4-ol?
4-[4-[1-(2,2-difluoroethyl)-3-phenylpyrazol-4-yl]-7-methoxyquinazolin-6-yl]oxan-4-ol has a molecular weight of 466.49 g/mol, XLogP of 4.43, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[1-(2,2-difluoroethyl)-3-phenylpyrazol-4-yl]-7-methoxyquinazolin-6-yl]oxan-4-ol is sourced from PubChem (CID 169231517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).