C22H17F2N7 — CID 169231854
4-[3-(2,6-difluorophenyl)-1-methylpyrazol-4-yl]-7-(1-methylpyrazol-3-yl)quinazolin-6-amine (PubChem CID 169231854) has the molecular formula C22H17F2N7 and a molecular weight of 417.42 g/mol. Its IUPAC name is 4-[3-(2,6-difluorophenyl)-1-methylpyrazol-4-yl]-7-(1-methylpyrazol-3-yl)quinazolin-6-amine.
| Compound Name | 4-[3-(2,6-difluorophenyl)-1-methylpyrazol-4-yl]-7-(1-methylpyrazol-3-yl)quinazolin-6-amine |
|---|---|
| PubChem CID | 169231854 |
| Molecular Formula | C22H17F2N7 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 4-[3-(2,6-difluorophenyl)-1-methylpyrazol-4-yl]-7-(1-methylpyrazol-3-yl)quinazolin-6-amine |
| SMILES | Cn1ccc(-c2cc3ncnc(-c4cn(C)nc4-c4c(F)cccc4F)c3cc2N)n1 |
| InChI | InChI=1S/C22H17F2N7/c1-30-7-6-18(28-30)12-9-19-13(8-17(12)25)21(27-11-26-19)14-10-31(2)29-22(14)20-15(23)4-3-5-16(20)24/h3-11H,25H2,1-2H3 |
| InChIKey | YHICKMGZMGSVBI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|