C27H24F2N6O — CID 169231897
4-[1-(2,2-difluoroethyl)-3-phenylpyrazol-4-yl]-6-(1-ethoxyethenyl)-7-(1-methylpyrazol-4-yl)quinazoline (PubChem CID 169231897) has the molecular formula C27H24F2N6O and a molecular weight of 486.53 g/mol. Its IUPAC name is 4-[1-(2,2-difluoroethyl)-3-phenylpyrazol-4-yl]-6-(1-ethoxyethenyl)-7-(1-methylpyrazol-4-yl)quinazoline.
| Compound Name | 4-[1-(2,2-difluoroethyl)-3-phenylpyrazol-4-yl]-6-(1-ethoxyethenyl)-7-(1-methylpyrazol-4-yl)quinazoline |
|---|---|
| PubChem CID | 169231897 |
| Molecular Formula | C27H24F2N6O |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 4-[1-(2,2-difluoroethyl)-3-phenylpyrazol-4-yl]-6-(1-ethoxyethenyl)-7-(1-methylpyrazol-4-yl)quinazoline |
| SMILES | C=C(OCC)c1cc2c(-c3cn(CC(F)F)nc3-c3ccccc3)ncnc2cc1-c1cnn(C)c1 |
| InChI | InChI=1S/C27H24F2N6O/c1-4-36-17(2)20-10-22-24(11-21(20)19-12-32-34(3)13-19)30-16-31-27(22)23-14-35(15-25(28)29)33-26(23)18-8-6-5-7-9-18/h5-14,16,25H,2,4,15H2,1,3H3 |
| InChIKey | OJIRKXUMOUTJNM-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|