About methyl 3-(2-nitrophenyl)propanoate;3-(2-nitrophenyl)propanoic acid
methyl 3-(2-nitrophenyl)propanoate;3-(2-nitrophenyl)propanoic acid (PubChem CID 169232729) has the molecular formula C19H20N2O8
and a molecular weight of 404.38 g/mol. Its IUPAC name is methyl 3-(2-nitrophenyl)propanoate;3-(2-nitrophenyl)propanoic acid.
Molecular Properties
| Compound Name | methyl 3-(2-nitrophenyl)propanoate;3-(2-nitrophenyl)propanoic acid |
| PubChem CID | 169232729 |
| Molecular Formula | C19H20N2O8 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | methyl 3-(2-nitrophenyl)propanoate;3-(2-nitrophenyl)propanoic acid |
| SMILES | COC(=O)CCc1ccccc1[N+](=O)[O-].O=C(O)CCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11NO4.C9H9NO4/c1-15-10(12)7-6-8-4-2-3-5-9(8)11(13)14;11-9(12)6-5-7-3-1-2-4-8(7)10(13)14/h2-5H,6-7H2,1H3;1-4H,5-6H2,(H,11,12) |
| InChIKey | GQQRSASDKRBBAW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 149.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(2-nitrophenyl)propanoate;3-(2-nitrophenyl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(2-nitrophenyl)propanoate;3-(2-nitrophenyl)propanoic acid?
The IUPAC name of methyl 3-(2-nitrophenyl)propanoate;3-(2-nitrophenyl)propanoic acid (CID 169232729) is methyl 3-(2-nitrophenyl)propanoate;3-(2-nitrophenyl)propanoic acid.
What is the SMILES notation for methyl 3-(2-nitrophenyl)propanoate;3-(2-nitrophenyl)propanoic acid?
The canonical SMILES for methyl 3-(2-nitrophenyl)propanoate;3-(2-nitrophenyl)propanoic acid is COC(=O)CCc1ccccc1[N+](=O)[O-].O=C(O)CCc1ccccc1[N+](=O)[O-].
What is the InChIKey of methyl 3-(2-nitrophenyl)propanoate;3-(2-nitrophenyl)propanoic acid?
The InChIKey is GQQRSASDKRBBAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO4.C9H9NO4/c1-15-10(12)7-6-8-4-2-3-5-9(8)11(13)14;11-9(12)6-5-7-3-1-2-4-8(7)10(13)14/h2-5H,6-7H2,1H3;1-4H,5-6H2,(H,11,12).
What are the key properties of methyl 3-(2-nitrophenyl)propanoate;3-(2-nitrophenyl)propanoic acid?
methyl 3-(2-nitrophenyl)propanoate;3-(2-nitrophenyl)propanoic acid has a molecular weight of 404.38 g/mol, XLogP of 3.31, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2-nitrophenyl)propanoate;3-(2-nitrophenyl)propanoic acid is sourced from PubChem (CID 169232729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).