C20H34N2 — CID 169233229
6-ethyl-2,3,5-trimethyl-4-[(1E,3Z)-6-methyl-2-propan-2-ylhepta-1,3,5-trienyl]-2,4-dihydro-1H-pyrimidine (PubChem CID 169233229) has the molecular formula C20H34N2 and a molecular weight of 302.51 g/mol. Its IUPAC name is 6-ethyl-2,3,5-trimethyl-4-[(1E,3Z)-6-methyl-2-propan-2-ylhepta-1,3,5-trienyl]-2,4-dihydro-1H-pyrimidine.
| Compound Name | 6-ethyl-2,3,5-trimethyl-4-[(1E,3Z)-6-methyl-2-propan-2-ylhepta-1,3,5-trienyl]-2,4-dihydro-1H-pyrimidine |
|---|---|
| PubChem CID | 169233229 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | 6-ethyl-2,3,5-trimethyl-4-[(1E,3Z)-6-methyl-2-propan-2-ylhepta-1,3,5-trienyl]-2,4-dihydro-1H-pyrimidine |
| SMILES | CCC1=C(C)C(/C=C(/C=C\C=C(C)C)C(C)C)N(C)C(C)N1 |
| InChI | InChI=1S/C20H34N2/c1-9-19-16(6)20(22(8)17(7)21-19)13-18(15(4)5)12-10-11-14(2)3/h10-13,15,17,20-21H,9H2,1-8H3/b12-10-,18-13- |
| InChIKey | POKXVDGSTJRJTD-GDMZXUIRSA-N |
| XLogP | 5.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|