C18H32FN2+ — CID 169233609
fluoromethyl-dimethyl-[(1Z,4E,6Z,8E)-2-methyl-1-(methylamino)-5-propan-2-yldeca-1,4,6,8-tetraen-3-yl]azanium (PubChem CID 169233609) has the molecular formula C18H32FN2+ and a molecular weight of 295.47 g/mol. Its IUPAC name is fluoromethyl-dimethyl-[(1Z,4E,6Z,8E)-2-methyl-1-(methylamino)-5-propan-2-yldeca-1,4,6,8-tetraen-3-yl]azanium.
| Compound Name | fluoromethyl-dimethyl-[(1Z,4E,6Z,8E)-2-methyl-1-(methylamino)-5-propan-2-yldeca-1,4,6,8-tetraen-3-yl]azanium |
|---|---|
| PubChem CID | 169233609 |
| Molecular Formula | C18H32FN2+ |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.25 |
| IUPAC Name | fluoromethyl-dimethyl-[(1Z,4E,6Z,8E)-2-methyl-1-(methylamino)-5-propan-2-yldeca-1,4,6,8-tetraen-3-yl]azanium |
| SMILES | C/C=C/C=C\C(=C\C(/C(C)=C\NC)[N+](C)(C)CF)C(C)C |
| InChI | InChI=1S/C18H32FN2/c1-8-9-10-11-17(15(2)3)12-18(16(4)13-20-5)21(6,7)14-19/h8-13,15,18,20H,14H2,1-7H3/q+1/b9-8+,11-10-,16-13-,17-12- |
| InChIKey | HERXNBYGYFGHML-ADQGHWTJSA-N |
| XLogP | 4.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|